|
CAS#: 110882-70-7 Product: N-(6-Chloro-5-Nitropyridin-2-Yl)Acetamide No suppilers available for the product. |
| Name | N-(6-Chloro-5-Nitropyridin-2-Yl)Acetamide |
|---|---|
| Synonyms | N-(6-Chloro-5-Nitro-2-Pyridyl)Acetamide; N-(6-Chloro-5-Nitro-Pyridin-2-Yl)Ethanamide; 2-Chloro-6-Acetylamino-3-Nitropyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClN3O3 |
| Molecular Weight | 215.60 |
| CAS Registry Number | 110882-70-7 |
| SMILES | C1=CC(=NC(=C1[N+]([O-])=O)Cl)NC(=O)C |
| InChI | 1S/C7H6ClN3O3/c1-4(12)9-6-3-2-5(11(13)14)7(8)10-6/h2-3H,1H3,(H,9,10,12) |
| InChIKey | KKTGQJSKUMYTQA-UHFFFAOYSA-N |
| Density | 1.545g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.806°C at 760 mmHg (Cal.) |
| Flash point | 230.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6-Chloro-5-Nitropyridin-2-Yl)Acetamide |