|
CAS#: 1114-91-6 Product: Octane-2,4,5,7-Tetrone No suppilers available for the product. |
| Name | Octane-2,4,5,7-Tetrone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 |
| CAS Registry Number | 1114-91-6 |
| EINECS | 214-218-0 |
| SMILES | C(C(C(CC(=O)C)=O)=O)C(=O)C |
| InChI | 1S/C8H10O4/c1-5(9)3-7(11)8(12)4-6(2)10/h3-4H2,1-2H3 |
| InChIKey | TVDDXVUEWIHEHC-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.254°C at 760 mmHg (Cal.) |
| Flash point | 99.948°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octane-2,4,5,7-Tetrone |