|
CAS#: 111456-84-9 Product: 1-(1,1-Diethoxyethyl)Imidazole No suppilers available for the product. |
| Name | 1-(1,1-Diethoxyethyl)Imidazole |
|---|---|
| Synonyms | Acetylimidazole Diethyl Acetal |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 |
| CAS Registry Number | 111456-84-9 |
| SMILES | C1=C[N](C=N1)C(OCC)(OCC)C |
| InChI | 1S/C9H16N2O2/c1-4-12-9(3,13-5-2)11-7-6-10-8-11/h6-8H,4-5H2,1-3H3 |
| InChIKey | WHHNCTBBIVAUTJ-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.367°C at 760 mmHg (Cal.) |
| Flash point | 119.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1-Diethoxyethyl)Imidazole |