|
CAS#: 111820-00-9 Product: N-[2-(2-Methylphenyl)Ethyl]Ethanimine Oxide No suppilers available for the product. |
| Name | N-[2-(2-Methylphenyl)Ethyl]Ethanimine Oxide |
|---|---|
| Synonyms | 1-Mpeeo; N-((1-Methyl-2-Phenyl)Ethyl)Ethanimine N-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 111820-00-9 |
| SMILES | C1=C(C(=CC=C1)CC[N+](=CC)[O-])C |
| InChI | 1S/C11H15NO/c1-3-12(13)9-8-11-7-5-4-6-10(11)2/h3-7H,8-9H2,1-2H3 |
| InChIKey | BDUSKLWORKOSHT-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.425°C at 760 mmHg (Cal.) |
| Flash point | 188.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(2-Methylphenyl)Ethyl]Ethanimine Oxide |