|
CAS#: 112077-92-6 Product: [Acetyl-(2-Methylphenyl)Amino] Acetate No suppilers available for the product. |
| Name | [Acetyl-(2-Methylphenyl)Amino] Acetate |
|---|---|
| Synonyms | Acetic Acid [Acetyl-(2-Methylphenyl)Amino] Ester; [Ethanoyl-(2-Methylphenyl)Amino] Ethanoate; Ccris 1239 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 112077-92-6 |
| SMILES | C1=C(C(=CC=C1)N(C(=O)C)OC(=O)C)C |
| InChI | 1S/C11H13NO3/c1-8-6-4-5-7-11(8)12(9(2)13)15-10(3)14/h4-7H,1-3H3 |
| InChIKey | FIHHAYPYTDZJBL-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.825°C at 760 mmHg (Cal.) |
| Flash point | 127.873°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Acetyl-(2-Methylphenyl)Amino] Acetate |