|
CAS#: 1130-49-0 Product: 2-Oxo-delta(3)-4,5,5-Trimethylcyclopentenylacetic Acid No suppilers available for the product. |
| Name | 2-Oxo-delta(3)-4,5,5-Trimethylcyclopentenylacetic Acid |
|---|---|
| Synonyms | 2-(5-Keto-2,2,3-Trimethyl-1-Cyclopent-3-Enyl)Acetic Acid; 2-(2,2,3-Trimethyl-5-Oxo-1-Cyclopent-3-Enyl)Ethanoic Acid; C07159 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 1130-49-0 |
| SMILES | C(C1C(C(=CC1=O)C)(C)C)C(O)=O |
| InChI | 1S/C10H14O3/c1-6-4-8(11)7(5-9(12)13)10(6,2)3/h4,7H,5H2,1-3H3,(H,12,13) |
| InChIKey | UJJNLVMCZZZXFW-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.166°C at 760 mmHg (Cal.) |
| Flash point | 166.479°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-delta(3)-4,5,5-Trimethylcyclopentenylacetic Acid |