|
CAS#: 113056-55-6 Product: Pseudophrynaminol No suppilers available for the product. |
| Name | Pseudophrynaminol |
|---|---|
| Synonyms | (E)-4-[(3Ar,8Br)-3-Methyl-1,2,3A,4-Tetrahydropyrrolo[2,3-B]Indol-8B-Yl]-2-Methyl-But-2-En-1-Ol; 2-Buten-1-Ol, 2-Methyl-4-(2,3,8,8A-Tetrahydro-1-Methylpyrrolo(2,3-B)Indol-3A(1H)-Yl)-, (3As-(3Aalpha(E),8Aalpha))-; 2-Methyl-4-(2,3,8,8A-Tetrahydro-1-Methylpyrrolo(2,3-B)Indol-3A(1H)-Yl)-2-Buten-1-Ol (3As-(3Aalpha(E),8Aalpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 |
| CAS Registry Number | 113056-55-6 |
| SMILES | [C@H]23NC1=CC=CC=C1[C@@]2(C\C=C(\CO)C)CCN3C |
| InChI | 1S/C16H22N2O/c1-12(11-19)7-8-16-9-10-18(2)15(16)17-14-6-4-3-5-13(14)16/h3-7,15,17,19H,8-11H2,1-2H3/b12-7+/t15-,16-/m1/s1 |
| InChIKey | YUFJTBNXHFFQKN-PWEFJHHISA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.568°C at 760 mmHg (Cal.) |
| Flash point | 199.685°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pseudophrynaminol |