|
CAS#: 114451-05-7 Product: 9,10-Dihydro-6,9,10-Trihydroxybenzo(b)Fluoranthene No suppilers available for the product. |
| Name | 9,10-Dihydro-6,9,10-Trihydroxybenzo(b)Fluoranthene |
|---|---|
| Synonyms | 9,10-Dihydro-6,9,10-Trihydroxybenzo(B)Fluoranthene; Benz(E)Acephenanthrylene-6,9,10-Triol, 9,10-Dihydro-, Trans-; Dh-6,9,10-Thbf |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.33 |
| CAS Registry Number | 114451-05-7 |
| SMILES | [C@@H]1(C3=C(C=C[C@@H]1O)C2=CC=CC4=C2C(=C3)C5=CC(=CC=C45)O)O |
| InChI | 1S/C20H14O3/c21-10-4-5-11-13-2-1-3-14-12-6-7-18(22)20(23)17(12)9-16(19(13)14)15(11)8-10/h1-9,18,20-23H/t18-,20-/m0/s1 |
| InChIKey | JJJOHZHXXPAIDI-ICSRJNTNSA-N |
| Density | 1.554g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.942°C at 760 mmHg (Cal.) |
| Flash point | 297.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-6,9,10-Trihydroxybenzo(b)Fluoranthene |