|
CAS#: 114460-41-2 Product: 2-Ethyl-3H-phenanthro(3,4-d)imidazol-10-ol No suppilers available for the product. |
| Name | 2-Ethyl-3H-phenanthro(3,4-d)imidazol-10-ol |
|---|---|
| Synonyms | Ccris 1763; 2-Ethyl-3H-Phenanthro(3,4-D)Imidazol-10-Ol; 3H-Phenanthro(3,4-D)Imidazol-10-Ol, 2-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 |
| CAS Registry Number | 114460-41-2 |
| SMILES | C1=C4C(=C2C(=C1)[NH]C(=N2)CC)C3=CC(=CC=C3C=C4)O |
| InChI | 1S/C17H14N2O/c1-2-15-18-14-8-6-11-4-3-10-5-7-12(20)9-13(10)16(11)17(14)19-15/h3-9,20H,2H2,1H3,(H,18,19) |
| InChIKey | NTGPGKFOILAMOT-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.406°C at 760 mmHg (Cal.) |
| Flash point | 316.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-3H-phenanthro(3,4-d)imidazol-10-ol |