|
CAS#: 114776-28-2 Product: Bepafant No suppilers available for the product. |
| Name | Bepafant |
|---|---|
| Synonyms | Bepafant [Inn]; Bepafanto [Inn-Spanish]; Web 2170 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.97 |
| CAS Registry Number | 114776-28-2 |
| SMILES | C6=C(C2=NCC1=NN=C([N]1C5=C2C3=C(CC(C3)C(N4CCOCC4)=O)S5)C)C(=CC=C6)Cl |
| InChI | 1S/C23H22ClN5O2S/c1-13-26-27-19-12-25-21(15-4-2-3-5-17(15)24)20-16-10-14(11-18(16)32-23(20)29(13)19)22(30)28-6-8-31-9-7-28/h2-5,14H,6-12H2,1H3 |
| InChIKey | FWYVRZOREBYLCY-UHFFFAOYSA-N |
| Density | 1.592g/cm3 (Cal.) |
|---|---|
| Boiling point | 744.538°C at 760 mmHg (Cal.) |
| Flash point | 404.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bepafant |