|
CAS#: 114884-46-7 Product: 3-[(3R,4R)-4-(3-Hydroxyphenyl)Hexan-3-Yl]Phenol No suppilers available for the product. |
| Name | 3-[(3R,4R)-4-(3-Hydroxyphenyl)Hexan-3-Yl]Phenol |
|---|---|
| Synonyms | 3-[(1R,2R)-1-Ethyl-2-(3-Hydroxyphenyl)Butyl]Phenol; 3,3'-Ddde; 3,3'-Dihydroxy-Alpha,Beta-Diethyldiphenylethane |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 114884-46-7 |
| SMILES | [C@@H]([C@H](C1=CC(=CC=C1)O)CC)(C2=CC(=CC=C2)O)CC |
| InChI | 1S/C18H22O2/c1-3-17(13-7-5-9-15(19)11-13)18(4-2)14-8-6-10-16(20)12-14/h5-12,17-20H,3-4H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KUJAWCSIKNKXLL-ROUUACIJSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.414°C at 760 mmHg (Cal.) |
| Flash point | 191.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(3R,4R)-4-(3-Hydroxyphenyl)Hexan-3-Yl]Phenol |