|
CAS#: 115-85-5 Product: (2-Chlorophenyl) Diphenyl Phosphate No suppilers available for the product. |
| Name | (2-Chlorophenyl) Diphenyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid (2-Chlorophenyl) Diphenyl Ester; Nsc2861; Phosphoric Acid, 2-Chlorophenyl Diphenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14ClO4P |
| Molecular Weight | 360.73 |
| CAS Registry Number | 115-85-5 |
| SMILES | C1=C(C=CC=C1)O[P](=O)(OC2=CC=CC=C2)OC3=CC=CC=C3Cl |
| InChI | 1S/C18H14ClO4P/c19-17-13-7-8-14-18(17)23-24(20,21-15-9-3-1-4-10-15)22-16-11-5-2-6-12-16/h1-14H |
| InChIKey | NMPAICLYKOKXAP-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.902°C at 760 mmHg (Cal.) |
| Flash point | 321.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chlorophenyl) Diphenyl Phosphate |