|
CAS#: 115876-62-5 Product: 3-Deoxyestradiol 17-Sulfate potassium salt No suppilers available for the product. |
| Name | 3-Deoxyestradiol 17-Sulfate potassium salt |
|---|---|
| Synonyms | 3-Deoxyestradiol 17-Sulfate; 3-Dess; Estra-1,3,5(10)-Trien-7-Ol, Hydrogen Sulfate, Potassium Salt, (17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23KO4S |
| Molecular Weight | 374.54 |
| CAS Registry Number | 115876-62-5 |
| SMILES | [C@H]34[C@H]2[C@@H](C1=CC=CC=C1CC2)CC[C@@]3([C@@H](O[S]([O-])(=O)=O)CC4)C.[K+] |
| InChI | 1S/C18H24O4S.K/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)22-23(19,20)21;/h2-5,14-17H,6-11H2,1H3,(H,19,20,21);/q;+1/p-1/t14-,15-,16+,17+,18+;/m1./s1 |
| InChIKey | UWWBAQHFYAWUGM-CMZLOHJFSA-M |
| Market Analysis Reports |
| List of Reports Available for 3-Deoxyestradiol 17-Sulfate potassium salt |