|
CAS#: 115-92-4 Product: Dimethyl (4-Sulfamoylphenyl) Phosphate No suppilers available for the product. |
| Name | Dimethyl (4-Sulfamoylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Dimethyl (4-Sulfamoylphenyl) Ester; 4-(Aminosulfonyl)Phenyl Dimethyl Phosphate; Ac 28,865 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12NO6PS |
| Molecular Weight | 281.22 |
| CAS Registry Number | 115-92-4 |
| SMILES | C1=C([S](=O)(=O)N)C=CC(=C1)O[P](=O)(OC)OC |
| InChI | 1S/C8H12NO6PS/c1-13-16(10,14-2)15-7-3-5-8(6-4-7)17(9,11)12/h3-6H,1-2H3,(H2,9,11,12) |
| InChIKey | QFPHHNFKPNIGGX-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.279°C at 760 mmHg (Cal.) |
| Flash point | 189.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4-Sulfamoylphenyl) Phosphate |