|
CAS#: 115453-71-9 Product: 3-((2-Chloroethenyl)Thio)-L-Alanine No suppilers available for the product. |
| Name | 3-((2-Chloroethenyl)Thio)-L-Alanine |
|---|---|
| Synonyms | (2R)-2-Amino-3-[(E)-2-Chlorovinyl]Sulfanyl-Propanoic Acid; (2R)-2-Amino-3-[[(E)-2-Chlorovinyl]Thio]Propanoic Acid; (2R)-2-Amino-3-[[(E)-2-Chlorovinyl]Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8ClNO2S |
| Molecular Weight | 181.64 |
| CAS Registry Number | 115453-71-9 |
| SMILES | [C@H](C(=O)O)(N)CS\C=C\Cl |
| InChI | 1S/C5H8ClNO2S/c6-1-2-10-3-4(7)5(8)9/h1-2,4H,3,7H2,(H,8,9)/b2-1+/t4-/m0/s1 |
| InChIKey | IPUYWODMJIEJQU-QPHDTYRISA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.357°C at 760 mmHg (Cal.) |
| Flash point | 141.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-((2-Chloroethenyl)Thio)-L-Alanine |