|
CAS#: 116049-87-7 Product: 2-Deoxy-2-Fluoroinositol No suppilers available for the product. |
| Name | 2-Deoxy-2-Fluoroinositol |
|---|---|
| Synonyms | Dl-Epi-Inositol, 2-Deoxy-2-Fluoro-; 2-Deoxy-2-Fluoro-Myo-Inositol; 2-Deoxy-2-Fluoroinositol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11FO5 |
| Molecular Weight | 182.15 |
| CAS Registry Number | 116049-87-7 |
| SMILES | [C@H]1(O)C(O)[C@H](O)[C@@H](O)C(F)[C@H]1O |
| InChI | 1S/C6H11FO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H/t1?,2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | PDTJJYSBSOKEOY-GCVPSNMTSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.749°C at 760 mmHg (Cal.) |
| Flash point | 138.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxy-2-Fluoroinositol |