|
CAS#: 1162-10-3 Product: Buphandrine No suppilers available for the product. |
| Name | Buphandrine |
|---|---|
| Synonyms | Nsc358661; Buphanidrin B678018k239 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 |
| CAS Registry Number | 1162-10-3 |
| SMILES | [C@]345C2=CC1=C(OCO1)C(=C2CN([C@@H]3C[C@H](C=C4)OC)CC5)OC |
| InChI | 1S/C18H21NO4/c1-20-11-3-4-18-5-6-19(15(18)7-11)9-12-13(18)8-14-17(16(12)21-2)23-10-22-14/h3-4,8,11,15H,5-7,9-10H2,1-2H3/t11-,15+,18+/m0/s1 |
| InChIKey | RNEXSBPDDRJJIY-BKGUAONASA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.694°C at 760 mmHg (Cal.) |
| Flash point | 137.453°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Buphandrine |