Online Database of Chemicals from Around the World
|
CAS#: 116229-70-0 Product: Actinoplanone E No suppilers available for the product. |
| Name | Actinoplanone E |
|---|---|
| Synonyms | Actinoplanone E |
| Molecular Structure |  |
| Molecular Formula | C31H29ClN2O10 |
| Molecular Weight | 625.03 |
| CAS Registry Number | 116229-70-0 |
| SMILES | C1=C7C(=C(O)C2=C1C(=C(N(N=C(C)C)C2=O)C)Cl)C4=C6C(=C3OC5=C(C(=O)C3=C4O)C(OC)CC(O)C5OC)OCOC6C7 |
| InChI | 1S/C31H29ClN2O10/c1-10(2)33-34-11(3)23(32)13-6-12-7-16-19-21(17(12)24(36)18(13)31(34)39)26(38)22-25(37)20-15(40-4)8-14(35)27(41-5)29(20)44-30(22)28(19)43-9-42-16/h6,14-16,27,35-36,38H,7-9H2,1-5H3 |
| InChIKey | RXQNODYVXOZZIK-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 874.813°C at 760 mmHg (Cal.) |
| Flash point | 482.87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Actinoplanone E |