|
CAS#: 116368-91-3 Product: Citlalitrione No suppilers available for the product. |
| Name | Citlalitrione |
|---|---|
| Synonyms | Cyclopenta(4',5')Cyclonona(1',2':1,5)Cyclopent(1,2-B)Oxirene-4,8,9(5H)-Trione, 5A,6,7,8A,9A,10,11,11A-Octahydro-3,6,6,8A,11-Pentamethyl-, (5Ar-(1Ar*,5Ar*,8As*,9As*,11R*,11As*))- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 |
| CAS Registry Number | 116368-91-3 |
| SMILES | [C@]12\4O[C@H]1[C@@H](C[C@@H]2C(=O)[C@]3([C@@H](C(CC3=O)(C)C)CC(=O)C(=C4)/C)C)C |
| InChI | 1S/C20H26O4/c1-10-6-12-16(23)19(5)14(18(3,4)9-15(19)22)7-13(21)11(2)8-20(12)17(10)24-20/h8,10,12,14,17H,6-7,9H2,1-5H3/b11-8+/t10-,12-,14-,17+,19+,20-/m1/s1 |
| InChIKey | AHQGAOBRELESIP-KDBIIAICSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.1±45.0°C at 760 mmHg (Cal.) |
| Flash point | 214.4±28.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Citlalitrione |