|
CAS#: 116374-64-2 Product: Methyl 9-(3-Dimethylaminopropylamino)-1-Nitroacridine-4-Carboxylate No suppilers available for the product. |
| Name | Methyl 9-(3-Dimethylaminopropylamino)-1-Nitroacridine-4-Carboxylate |
|---|---|
| Synonyms | Methyl 9-(3-Dimethylaminopropylamino)-1-Nitro-Acridine-4-Carboxylate; 9-(3-Dimethylaminopropylamino)-1-Nitro-4-Acridinecarboxylic Acid Methyl Ester; 9-(3-Dimethylaminopropylamino)-1-Nitro-Acridine-4-Carboxylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 |
| CAS Registry Number | 116374-64-2 |
| SMILES | C2=CC(=C1N=C3C(=C(NCCCN(C)C)C1=C2[N+]([O-])=O)C=CC=C3)C(OC)=O |
| InChI | 1S/C20H22N4O4/c1-23(2)12-6-11-21-18-13-7-4-5-8-15(13)22-19-14(20(25)28-3)9-10-16(17(18)19)24(26)27/h4-5,7-10H,6,11-12H2,1-3H3,(H,21,22) |
| InChIKey | LJNIDEWFUGGGMV-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.013°C at 760 mmHg (Cal.) |
| Flash point | 309.419°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 9-(3-Dimethylaminopropylamino)-1-Nitroacridine-4-Carboxylate |