|
CAS#: 116589-63-0 Product: Poly(Propylenefumarate) Methylmethacrylate No suppilers available for the product. |
| Name | Poly(Propylenefumarate) Methylmethacrylate |
|---|---|
| Synonyms | But-2-Enedioic Acid; 2-Methylprop-2-Enoic Acid Methyl Ester; Propane-1,2-Diol; But-2-Enedioic Acid; 2-Methylacrylic Acid Methyl Ester; Propane-1,2-Diol |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.29 |
| CAS Registry Number | 116589-63-0 |
| SMILES | CC(C(OC)=O)=C.O=C(O)\C=C\C(=O)O.C(O)C(O)C |
| InChI | 1S/C5H8O2.C4H4O4.C3H8O2/c1-4(2)5(6)7-3;5-3(6)1-2-4(7)8;1-3(5)2-4/h1H2,2-3H3;1-2H,(H,5,6)(H,7,8);3-5H,2H2,1H3/b;2-1+; |
| InChIKey | SSWNFQJXXJRIRY-JITBQSAISA-N |
| Boiling point | 355.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(Propylenefumarate) Methylmethacrylate |