|
CAS#: 116763-36-1 Product: 7-(1,3-Dithiolan-2-ylmethyl)-1,3-dimethylxanthine No suppilers available for the product. |
| Name | 7-(1,3-Dithiolan-2-ylmethyl)-1,3-dimethylxanthine |
|---|---|
| Synonyms | 7-(1,3-Dithiolan-2-Ylmethyl)-1,3-Dimethyl-Purine-2,6-Dione; 7-(1,3-Dithiolan-2-Ylmethyl)-1,3-Dimethyl-Xanthine; 1H-Purine-2,6-Dione, 3,7-Dihydro-1,3-Dimethyl-7-(1,3-Dithiolan-2-Ylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 116763-36-1 |
| SMILES | C1=NC3=C([N]1CC2SCCS2)C(N(C)C(N3C)=O)=O |
| InChI | 1S/C11H14N4O2S2/c1-13-9-8(10(16)14(2)11(13)17)15(6-12-9)5-7-18-3-4-19-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | HIQUBRAKVZRBRW-UHFFFAOYSA-N |
| Density | 1.629g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.868°C at 760 mmHg (Cal.) |
| Flash point | 292.398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(1,3-Dithiolan-2-ylmethyl)-1,3-dimethylxanthine |