|
CAS#: 117191-32-9 Product: 9-(4-Hydroxy-2-(Hydroxymethyl)Butyl)-Guanine Triphosphate No suppilers available for the product. |
| Name | 9-(4-Hydroxy-2-(Hydroxymethyl)Butyl)-Guanine Triphosphate |
|---|---|
| Synonyms | [3-[(2-Amino-6-Oxo-3H-Purin-9-Yl)Methyl]-4-Hydroxy-Butyl] Diphosphono Phosphate; Phosphoric Acid [3-[(2-Amino-6-Oxo-3H-Purin-9-Yl)Methyl]-4-Hydroxybutyl] Diphosphono Ester; Phosphoric Acid [3-[(2-Amino-6-Keto-3H-Purin-9-Yl)Methyl]-4-Hydroxy-Butyl] Diphosphono Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N5O12P3 |
| Molecular Weight | 493.20 |
| CAS Registry Number | 117191-32-9 |
| SMILES | C1=NC2=C([N]1CC(CCO[P](O[P](O)(O)=O)(O[P](O)(O)=O)=O)CO)NC(=NC2=O)N |
| InChI | 1S/C10H18N5O12P3/c11-10-13-8-7(9(17)14-10)12-5-15(8)3-6(4-16)1-2-25-30(24,26-28(18,19)20)27-29(21,22)23/h5-6,16H,1-4H2,(H2,18,19,20)(H2,21,22,23)(H3,11,13,14,17) |
| InChIKey | LULDFWDKTKFRNX-UHFFFAOYSA-N |
| Density | 2.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 931.211°C at 760 mmHg (Cal.) |
| Flash point | 516.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(4-Hydroxy-2-(Hydroxymethyl)Butyl)-Guanine Triphosphate |