|
CAS#: 117333-21-8 Product: 2-Hydroxy-(1-N-Nitrosoindole)Propionicacid No suppilers available for the product. |
| Name | 2-Hydroxy-(1-N-Nitrosoindole)Propionicacid |
|---|---|
| Synonyms | 2-Hydroxy-3-(1-Nitroso-3-Indolyl)Propanoic Acid; 2-Hydroxy-3-(1-Nitrosoindol-3-Yl)Propionic Acid; 1H-Indole-3-Propanoic Acid, Alpha-Hydroxy-1-Nitroso- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 |
| CAS Registry Number | 117333-21-8 |
| SMILES | C1=C(C2=C([N]1N=O)C=CC=C2)CC(C(=O)O)O |
| InChI | 1S/C11H10N2O4/c14-10(11(15)16)5-7-6-13(12-17)9-4-2-1-3-8(7)9/h1-4,6,10,14H,5H2,(H,15,16) |
| InChIKey | BSAHBIFSJDNPFG-UHFFFAOYSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.68°C at 760 mmHg (Cal.) |
| Flash point | 249.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-(1-N-Nitrosoindole)Propionicacid |