|
CAS#: 117989-29-4 Product: Pigment Red 257 No suppilers available for the product. |
| Name | Pigment Red 257 |
|---|---|
| Synonyms | (4,5,6,7-Tetrachloro-3-Nitroso-2H-Isoindol-1-Yl)Amine; Bis(3-Amino-4,5,6,7-Tetrachloro-1H-Isoindol-1-One Oximato-N2,O1)Nickel |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3Cl4N3O |
| Molecular Weight | 298.94 |
| CAS Registry Number | 117989-29-4 |
| EINECS | 274-916-6 |
| SMILES | C1(=C2C(=C([NH]1)N=O)C(=C(Cl)C(=C2Cl)Cl)Cl)N |
| InChI | 1S/C8H3Cl4N3O/c9-3-1-2(4(10)6(12)5(3)11)8(15-16)14-7(1)13/h14H,13H2 |
| InChIKey | WXZBOVPHFPDVFK-UHFFFAOYSA-N |
| Density | 2.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.231°C at 760 mmHg (Cal.) |
| Flash point | 305.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pigment Red 257 |