|
CAS#: 117994-64-6 Product: Etoxadrol-2-Isothiocyanate No suppilers available for the product. |
| Name | Etoxadrol-2-Isothiocyanate |
|---|---|
| Synonyms | (2-Ethyl-2-(3-Isothiocyanatophenyl)-2-Piperidyl)-1,3-Dioxolane; Etoxadrol-2-Isothiocyanate; Etoxadrol-Meta-Isothiocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.43 |
| CAS Registry Number | 117994-64-6 |
| SMILES | [C@@H]1(NCCCC1)[C@@H]2O[C@](OC2)(C3=CC=CC(=C3)N=C=S)CC |
| InChI | 1S/C17H22N2O2S/c1-2-17(13-6-5-7-14(10-13)19-12-22)20-11-16(21-17)15-8-3-4-9-18-15/h5-7,10,15-16,18H,2-4,8-9,11H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | YLEFFVJJULTPHH-BBWFWOEESA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.899°C at 760 mmHg (Cal.) |
| Flash point | 236.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Etoxadrol-2-Isothiocyanate |