|
CAS#: 118104-82-8 Product: O-[(2S)-2-Amino-3-Phenylpropyl] (Phenylamino)Methanethioate No suppilers available for the product. |
| Name | O-[(2S)-2-Amino-3-Phenylpropyl] (Phenylamino)Methanethioate |
|---|---|
| Synonyms | O-[(2S)-2-Amino-3-Phenyl-Propyl] (Phenylamino)Methanethioate; (Phenylamino)Methanethioic Acid O-[(2S)-2-Amino-3-Phenylpropyl] Ester; (Phenylamino)Methanethioic Acid O-[(2S)-2-Amino-3-Phenyl-Propyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.39 |
| CAS Registry Number | 118104-82-8 |
| SMILES | [C@@H](COC(NC1=CC=CC=C1)=S)(CC2=CC=CC=C2)N |
| InChI | 1S/C16H18N2OS/c17-14(11-13-7-3-1-4-8-13)12-19-16(20)18-15-9-5-2-6-10-15/h1-10,14H,11-12,17H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | RNXJOHPVZIKWLE-AWEZNQCLSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.346°C at 760 mmHg (Cal.) |
| Flash point | 215.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-[(2S)-2-Amino-3-Phenylpropyl] (Phenylamino)Methanethioate |