|
CAS#: 118143-01-4 Product: (3alpha,4beta,8alpha)-12,13-Epoxy-Trichothec-9-Ene-3,4,8,15-Tetrol 4,15-Diacetate 8-Hexanoate No suppilers available for the product. |
| Name | (3alpha,4beta,8alpha)-12,13-Epoxy-Trichothec-9-Ene-3,4,8,15-Tetrol 4,15-Diacetate 8-Hexanoate |
|---|---|
| Synonyms | 8-Hexanoylneosolaniol; 8-N-Hexanoylneosolaniol |
| Molecular Structure | ![]() |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 |
| CAS Registry Number | 118143-01-4 |
| SMILES | [C@@]24(C1(OC1)[C@H](O[C@H]3[C@@]2(C[C@H](OC(=O)CCCCC)C(=C3)C)COC(=O)C)[C@H](O)[C@H]4OC(=O)C)C |
| InChI | 1S/C25H36O9/c1-6-7-8-9-19(28)33-17-11-24(12-30-15(3)26)18(10-14(17)2)34-22-20(29)21(32-16(4)27)23(24,5)25(22)13-31-25/h10,17-18,20-22,29H,6-9,11-13H2,1-5H3/t17-,18+,20+,21+,22+,23+,24+,25?/m0/s1 |
| InChIKey | NTQOBLPQKXJXCZ-BFAIXHJHSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.99°C at 760 mmHg (Cal.) |
| Flash point | 180.334°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha,4beta,8alpha)-12,13-Epoxy-Trichothec-9-Ene-3,4,8,15-Tetrol 4,15-Diacetate 8-Hexanoate |