|
CAS#: 118993-57-0 Product: 4-(4-Hydroxybenzoyl)-2-Thiophenesulfonamide No suppilers available for the product. |
| Name | 4-(4-Hydroxybenzoyl)-2-Thiophenesulfonamide |
|---|---|
| Synonyms | 4-(4-Hydroxy-benzoyl)-thiophene-2-sulfonic acid amide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO4S2 |
| Molecular Weight | 283.32 |
| CAS Registry Number | 118993-57-0 |
| SMILES | C1=CC(=CC=C1C(=O)C2=CSC(=C2)S(=O)(=O)N)O |
| InChI | 1S/C11H9NO4S2/c12-18(15,16)10-5-8(6-17-10)11(14)7-1-3-9(13)4-2-7/h1-6,13H,(H2,12,15,16) |
| InChIKey | OJXOXNIZNJIMLU-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.4±60.0°C at 760 mmHg (Cal.) |
| Flash point | 303.6±32.9°C (Cal.) |
| Refractive index | 1.663 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Hydroxybenzoyl)-2-Thiophenesulfonamide |