|
CAS#: 119237-63-7 Product: 10-(3',5'-Dimethylphenyl)-3-Methylflavin No suppilers available for the product. |
| Name | 10-(3',5'-Dimethylphenyl)-3-Methylflavin |
|---|---|
| Synonyms | 10-(3,5-Dimethylphenyl)-3,7,8-Trimethyl-Benzo[G]Pteridine-2,4-Dione; 10-(3,5-Dimethylphenyl)-3,7,8-Trimethyl-Benzo[G]Pteridine-2,4-Quinone; 10-(3',5'-Dimethylphenyl)-3-Methylflavin |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.41 |
| CAS Registry Number | 119237-63-7 |
| SMILES | C1=C3C(=CC(=C1C)C)N=C2C(N(C(N=C2N3C4=CC(=CC(=C4)C)C)=O)C)=O |
| InChI | 1S/C21H20N4O2/c1-11-6-12(2)8-15(7-11)25-17-10-14(4)13(3)9-16(17)22-18-19(25)23-21(27)24(5)20(18)26/h6-10H,1-5H3 |
| InChIKey | PTMUTTBBHPNBNE-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.879°C at 760 mmHg (Cal.) |
| Flash point | 280.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-(3',5'-Dimethylphenyl)-3-Methylflavin |