|
CAS#: 119767-03-2 Product: Homoharringtonamide No suppilers available for the product. |
| Name | Homoharringtonamide |
|---|---|
| Synonyms | Cephalotaxine, 8-Oxo-, 4-Methyl 2-Hydroxy-2-(4-Hydroxy-4-Methypentyl)Butanedioate (Ester), (3(R))- |
| Molecular Structure | ![]() |
| Molecular Formula | C29H37NO10 |
| Molecular Weight | 559.61 |
| CAS Registry Number | 119767-03-2 |
| SMILES | [C@H]25[C@@]1(N(C(=O)CC1)CCC4=C2C=C3OCOC3=C4)C=C(OC)[C@H]5OC(=O)[C@](O)(CC(OC)=O)CCCC(O)(C)C |
| InChI | 1S/C29H37NO10/c1-27(2,34)8-5-9-29(35,15-23(32)37-4)26(33)40-25-21(36-3)14-28-10-6-22(31)30(28)11-7-17-12-19-20(39-16-38-19)13-18(17)24(25)28/h12-14,24-25,34-35H,5-11,15-16H2,1-4H3/t24-,25+,28-,29+/m0/s1 |
| InChIKey | YOJBNRXCKCTVGL-YDEMYLEWSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 759.093°C at 760 mmHg (Cal.) |
| Flash point | 412.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Homoharringtonamide |