|
CAS#: 119772-49-5 Product: 1-Deoxy-1-(Methyl(1-Oxoundecyl)Amino)-D-Glucitol No suppilers available for the product. |
| Name | 1-Deoxy-1-(Methyl(1-Oxoundecyl)Amino)-D-Glucitol |
|---|---|
| Synonyms | Mega 11; Mega-11; 1-Deoxy-(N-Methylundecanamido)-D-Glucitol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H37NO6 |
| Molecular Weight | 363.49 |
| CAS Registry Number | 119772-49-5 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](CN(C(CCCCCCCCCC)=O)C)O)O)O)O |
| InChI | 1S/C18H37NO6/c1-3-4-5-6-7-8-9-10-11-16(23)19(2)12-14(21)17(24)18(25)15(22)13-20/h14-15,17-18,20-22,24-25H,3-13H2,1-2H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | PGNXLDQQCINNPZ-BURFUSLBSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.487°C at 760 mmHg (Cal.) |
| Flash point | 318.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Deoxy-1-(Methyl(1-Oxoundecyl)Amino)-D-Glucitol |