| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Indofine Chemical Company, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | (7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Tetradecene |
|---|---|
| Synonyms | 1-(Perfluorohexyl)oct-1-ene; 1-(Perfluorohexyl)oct-1-ene 95%; MFCD00042354 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15F13 |
| Molecular Weight | 430.25 |
| CAS Registry Number | 120464-26-8 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)/C=C/CCCCCC |
| InChI | 1S/C14H15F13/c1-2-3-4-5-6-7-8-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7-8H,2-6H2,1H3/b8-7+ |
| InChIKey | JNMMIYWYYKPWFO-BQYQJAHWSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.369°C at 760 mmHg (Cal.) |
| Flash point | 94.48°C (Cal.) |
| Refractive index | 1.345 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Irritant | |
| R36/37/38 | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Tetradecene |