|
CAS#: 120924-91-6 Product: 2-Chloro-3-Methylbicyclo[2.2.1]Hept-5-Ene-2-Carbonyl Chloride No suppilers available for the product. |
| Name | 2-Chloro-3-Methylbicyclo[2.2.1]Hept-5-Ene-2-Carbonyl Chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 |
| CAS Registry Number | 120924-91-6 |
| SMILES | CC1C2CC(C1(C(=O)Cl)Cl)C=C2 |
| InChI | 1S/C9H10Cl2O/c1-5-6-2-3-7(4-6)9(5,11)8(10)12/h2-3,5-7H,4H2,1H3 |
| InChIKey | NPXWXRQXIDRWDU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 100.2±27.7°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3-Methylbicyclo[2.2.1]Hept-5-Ene-2-Carbonyl Chloride |