| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Chemodex Ltd. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | 2,5-Bis(2-Methyl-2-Propanyl)-1,3-Cyclopentadiene |
| Synonyms | Di-tert-butylcyclopentadiene; 34655_FLUKA |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.31 |
| CAS Registry Number | 120937-44-2 |
| SMILES | C\1=C\C(=C/C/1C(C)(C)C)C(C)(C)C |
| InChI | 1S/C13H22/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | RADVPPBTEASJRZ-UHFFFAOYSA-N |
| Density | 0.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.402°C at 760 mmHg (Cal.) |
| Flash point | 75.588°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(2-Methyl-2-Propanyl)-1,3-Cyclopentadiene |