|
CAS#: 120973-21-9 Product: 17-(Cyclopropylamino)Androst-5-En-3-Ol No suppilers available for the product. |
| Name | 17-(Cyclopropylamino)Androst-5-En-3-Ol |
|---|---|
| Synonyms | 17-(Cyclopropylamino)Androst-5-En-3-Ol; Mdl 27,302; Mdl 27302 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.52 |
| CAS Registry Number | 120973-21-9 |
| SMILES | [C@@H]23CC=C1CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CCC4NC5CC5)C)C)O |
| InChI | 1S/C22H35NO/c1-21-11-9-16(24)13-14(21)3-6-17-18-7-8-20(23-15-4-5-15)22(18,2)12-10-19(17)21/h3,15-20,23-24H,4-13H2,1-2H3/t16?,17-,18-,19-,20?,21-,22-/m0/s1 |
| InChIKey | SIHFFPMAENZEHO-YCJMKONYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.254°C at 760 mmHg (Cal.) |
| Flash point | 79.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-(Cyclopropylamino)Androst-5-En-3-Ol |