|
CAS#: 121067-53-6 Product: (E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enyl)Hept-4-Ene-2,3,6-Triol No suppilers available for the product. |
| Name | (E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enyl)Hept-4-Ene-2,3,6-Triol |
|---|---|
| Synonyms | 4-Heptene-2,3,6-Triol, 2-Methyl-6-(4-Methyl-3-Cyclohexen-1-Yl)-; Yingzhaosu D |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 |
| CAS Registry Number | 121067-53-6 |
| SMILES | CC(C(\C=C\C(C)(O)C1CC=C(CC1)C)O)(O)C |
| InChI | 1S/C15H26O3/c1-11-5-7-12(8-6-11)15(4,18)10-9-13(16)14(2,3)17/h5,9-10,12-13,16-18H,6-8H2,1-4H3/b10-9+ |
| InChIKey | LWZJOPWOCKMHSC-MDZDMXLPSA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.504°C at 760 mmHg (Cal.) |
| Flash point | 195.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enyl)Hept-4-Ene-2,3,6-Triol |