|
CAS#: 121739-39-7 Product: 19-Hydroxy-4-Androsten-17-One No suppilers available for the product. |
| Name | 19-Hydroxy-4-Androsten-17-One |
|---|---|
| Synonyms | (8R,9S,10S,13S,14S)-13-Methyl-10-Methylol-1,2,3,6,7,8,9,11,12,14,15,16-Dodecahydrocyclopenta[A]Phenanthren-17-One; 19-Hado; 19-Hydroxy-4-Androsten-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 |
| CAS Registry Number | 121739-39-7 |
| SMILES | [C@H]23[C@@H]([C@@]1(C(=CCCC1)CC2)CO)CC[C@]4([C@H]3CCC4=O)C |
| InChI | 1S/C19H28O2/c1-18-11-9-16-14(15(18)7-8-17(18)21)6-5-13-4-2-3-10-19(13,16)12-20/h4,14-16,20H,2-3,5-12H2,1H3/t14-,15-,16-,18-,19+/m0/s1 |
| InChIKey | UGCIHWZOIVCJGP-BGJMDTOESA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.347°C at 760 mmHg (Cal.) |
| Flash point | 185.246°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Hydroxy-4-Androsten-17-One |