|
CAS#: 122436-39-9 Product: Yttrium Ethylenediaminetetra(Methylenephosphonic Acid) No suppilers available for the product. |
| Name | Yttrium Ethylenediaminetetra(Methylenephosphonic Acid) |
|---|---|
| Synonyms | 2-(Bis(Phosphonatomethyl)Amino)Ethyl-Bis(Phosphonatomethyl)Amine; Yttrium(+3) Cation; Yttrate(5-)-(90)-Y, (((1,2-Ethanediylbis(Nitrilobis(Methylene)))Tetrakis(Phosphonato))(8-)-N,N',O(P),O(P'),O(P''),O(P'''))-, (Oc-6-21)-; Yttrium Ethylenediaminetetra(Methylenephosphonic Acid) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N2O12P4Y |
| Molecular Weight | 516.97 |
| CAS Registry Number | 122436-39-9 |
| SMILES | [90Y+3].C([P]([O-])([O-])=O)N(C[P]([O-])([O-])=O)CCN(C[P]([O-])([O-])=O)C[P]([O-])([O-])=O |
| InChI | 1S/C6H20N2O12P4.Y/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20;/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20);/q;+3/p-8/i;1+1 |
| InChIKey | SIYJWCLKTLNSHT-IEOVAKBOSA-F |
| Boiling point | 878.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 485.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Yttrium Ethylenediaminetetra(Methylenephosphonic Acid) |