|
CAS#: 12286-76-9 Product: Ferric Fructose No suppilers available for the product. |
| Name | Ferric Fructose |
|---|---|
| Synonyms | Ferric Potassium (2S,3S,4R,5R)-2-(Hydroxymethyl)Tetrahydropyran-2,3,4,5-Tetrol; Ferric Potassium (2S,3S,4R,5R)-2-Methyloltetrahydropyran-2,3,4,5-Tetrol; Fructose Iron Complex, Compound With Potassium (2:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12FeKO6 |
| Molecular Weight | 275.10 |
| CAS Registry Number | 12286-76-9 |
| EINECS | 235-559-1 |
| SMILES | [C@]1(OC[C@@H](O)[C@@H](O)[C@@H]1O)(O)CO.[K+].[Fe+3] |
| InChI | 1S/C6H12O6.Fe.K/c7-2-6(11)5(10)4(9)3(8)1-12-6;;/h3-5,7-11H,1-2H2;;/q;+3;+1/t3-,4-,5+,6+;;/m1../s1 |
| InChIKey | SPNHUEKXVKBAQQ-WMUOJARJSA-N |
| Boiling point | 401.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ferric Fructose |