|
CAS#: 125421-23-0 Product: 2-[(2-Aminophenyl)Carbamothioylamino]-4-Methylpentanoic Acid No suppilers available for the product. |
| Name | 2-[(2-Aminophenyl)Carbamothioylamino]-4-Methylpentanoic Acid |
|---|---|
| Synonyms | 2-[(2-Aminophenyl)Carbamothioylamino]-4-Methyl-Pentanoic Acid; 2-[[[(2-Aminophenyl)Amino]-Thioxomethyl]Amino]-4-Methylpentanoic Acid; 2-[(2-Aminophenyl)Thiocarbamoylamino]-4-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.37 |
| CAS Registry Number | 125421-23-0 |
| SMILES | C1=C(NC(=S)NC(C(=O)O)CC(C)C)C(=CC=C1)N |
| InChI | 1S/C13H19N3O2S/c1-8(2)7-11(12(17)18)16-13(19)15-10-6-4-3-5-9(10)14/h3-6,8,11H,7,14H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | GLGSSJBUQGGWJS-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.47°C at 760 mmHg (Cal.) |
| Flash point | 227.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Aminophenyl)Carbamothioylamino]-4-Methylpentanoic Acid |