|
CAS#: 125973-91-3 Product: 2-Amino-7-(2-Fluoroethyl)-3H-Purin-6-One No suppilers available for the product. |
| Name | 2-Amino-7-(2-Fluoroethyl)-3H-Purin-6-One |
|---|---|
| Synonyms | 6H-Purin-6-One, 2-Amino-7-(2-Fluoroethyl)-1,7-Dihydro-; 7-(2'-Fluoroethyl)Guanine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8FN5O |
| Molecular Weight | 197.17 |
| CAS Registry Number | 125973-91-3 |
| SMILES | C1=NC2=C([N]1CCF)C(=O)N=C(N2)N |
| InChI | 1S/C7H8FN5O/c8-1-2-13-3-10-5-4(13)6(14)12-7(9)11-5/h3H,1-2H2,(H3,9,11,12,14) |
| InChIKey | GFUOKMKKHLGCAB-UHFFFAOYSA-N |
| Density | 1.79g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.294°C at 760 mmHg (Cal.) |
| Flash point | 265.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-7-(2-Fluoroethyl)-3H-Purin-6-One |