|
CAS#: 126572-78-9 Product: (Z)-2,4,4-Trichloro-3-(Hydroxymethyl)But-2-Enoic Acid No suppilers available for the product. |
| Name | (Z)-2,4,4-Trichloro-3-(Hydroxymethyl)But-2-Enoic Acid |
|---|---|
| Synonyms | (Z)-2,4,4-Trichloro-3-Methylol-But-2-Enoic Acid; (Z)-2-Chloro-3-(Dichloromethyl)-4-Hydroxybut-2-Enoic Acid; 2-Butenoic Acid, 2-Chloro-3-(Dichloromethyl)-4-Hydroxy-, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H5Cl3O3 |
| Molecular Weight | 219.45 |
| CAS Registry Number | 126572-78-9 |
| SMILES | C(O)\C(=C(Cl)/C(=O)O)C(Cl)Cl |
| InChI | 1S/C5H5Cl3O3/c6-3(5(10)11)2(1-9)4(7)8/h4,9H,1H2,(H,10,11)/b3-2- |
| InChIKey | SHGAIAGWDXHJHG-IHWYPQMZSA-N |
| Density | 1.676g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.576°C at 760 mmHg (Cal.) |
| Flash point | 236.582°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-2,4,4-Trichloro-3-(Hydroxymethyl)But-2-Enoic Acid |