|
CAS#: 128129-56-6 Product: Phlorofucofuroeckol A No suppilers available for the product. |
| Name | Phlorofucofuroeckol A |
|---|---|
| Synonyms | Benzo(B)Benzofuro(3,2-F)(1,4)Benzodioxin-1,3,6,10,12-Pentol, 4,9-Bis(3,5-Dihydroxyphenoxy)-; Phlorofucofuroeckol A; 5,8,13-Trioxaindeno[1,2-A]Anthracene-1,3,6,10,12-Pentol, 4,9-Bis(3,5-Dihydroxyphenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H18O14 |
| Molecular Weight | 602.46 |
| CAS Registry Number | 128129-56-6 |
| SMILES | C4=C(O)C1=C(OC2=C(O1)C(=C(O)C=C2O)OC3=CC(=CC(=C3)O)O)C5=C4OC6=C5C(=CC(=C6OC7=CC(=CC(=C7)O)O)O)O |
| InChI | 1S/C30H18O14/c31-10-1-11(32)4-14(3-10)40-24-17(36)7-16(35)22-23-21(42-28(22)24)9-20(39)25-29(23)43-27-19(38)8-18(37)26(30(27)44-25)41-15-5-12(33)2-13(34)6-15/h1-9,31-39H |
| InChIKey | SLWPBUMYPRVYIJ-UHFFFAOYSA-N |
| Density | 1.847g/cm3 (Cal.) |
|---|---|
| Boiling point | 810.945°C at 760 mmHg (Cal.) |
| Flash point | 444.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phlorofucofuroeckol A |