|
CAS#: 128759-76-2 Product: 2-(Nitrooxy)Ethyl Apovincaminate No suppilers available for the product. |
| Name | 2-(Nitrooxy)Ethyl Apovincaminate |
|---|---|
| Synonyms | Eburnamenine-14 Carboxylic Acid (2-Nitroxyethyl)Ester; Eburnamenine-14-Carboxylic Acid, 2-(Nitrooxy)Ethyl Ester, (3Alpha,16Alpha)-; Noetapov |
| Molecular Structure | ![]() |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 |
| CAS Registry Number | 128759-76-2 |
| SMILES | [C@@H]14N5CCC2=C1[N](C3=CC=CC=C23)C(=C[C@@]4(CCC5)CC)C(OCCO[N+]([O-])=O)=O |
| InChI | 1S/C22H25N3O5/c1-2-22-9-5-10-23-11-8-16-15-6-3-4-7-17(15)24(19(16)20(22)23)18(14-22)21(26)29-12-13-30-25(27)28/h3-4,6-7,14,20H,2,5,8-13H2,1H3/t20-,22+/m1/s1 |
| InChIKey | VDHLDQHKSSLLJV-IRLDBZIGSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.424°C at 760 mmHg (Cal.) |
| Flash point | 252.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Nitrooxy)Ethyl Apovincaminate |