|
CAS#: 128837-83-2 Product: N-(3-Fluoropropyl)-N-norbuprenorphine No suppilers available for the product. |
| Name | N-(3-Fluoropropyl)-N-norbuprenorphine |
|---|---|
| Synonyms | N-(3-Fluoropropyl)-N-Norbuprenorphine |
| Molecular Structure | ![]() |
| Molecular Formula | C28H40FNO4 |
| Molecular Weight | 473.63 |
| CAS Registry Number | 128837-83-2 |
| SMILES | C1=CC(=C5C2=C1CC4C36CC(C(C(C23CCN4CCCF)O5)(OC)CC6)C(C(C)(C)C)(O)C)O |
| InChI | 1S/C28H40FNO4/c1-24(2,3)25(4,32)19-16-26-9-10-28(19,33-5)23-27(26)11-14-30(13-6-12-29)20(26)15-17-7-8-18(31)22(34-23)21(17)27/h7-8,19-20,23,31-32H,6,9-16H2,1-5H3 |
| InChIKey | LPNOOYPIGSPXRX-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.805°C at 760 mmHg (Cal.) |
| Flash point | 309.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Fluoropropyl)-N-norbuprenorphine |