|
CAS#: 13012-93-6 Product: 3-(2-Aminoethyl)-1-Benzothiophene-5-Ol No suppilers available for the product. |
| Name | 3-(2-Aminoethyl)-1-Benzothiophene-5-Ol |
|---|---|
| Synonyms | 3-(2-Aminoethyl)Benzothiophen-5-Ol; 3-(2-Aminoethyl)-5-Benzothiophenol; Brn 1309943 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.26 |
| CAS Registry Number | 13012-93-6 |
| SMILES | C1=C(O)C=CC2=C1C(=CS2)CCN |
| InChI | 1S/C10H11NOS/c11-4-3-7-6-13-10-2-1-8(12)5-9(7)10/h1-2,5-6,12H,3-4,11H2 |
| InChIKey | ONTWCYDBNXHETF-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.897°C at 760 mmHg (Cal.) |
| Flash point | 185.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Aminoethyl)-1-Benzothiophene-5-Ol |