|
CAS#: 130203-74-6 Product: 2,2-Bis(4-Chlorophenyl)-N-(2-Hydroxybutyl)Acetamide No suppilers available for the product. |
| Name | 2,2-Bis(4-Chlorophenyl)-N-(2-Hydroxybutyl)Acetamide |
|---|---|
| Synonyms | 2,2-Bis(4-Chlorophenyl)-N-(2-Hydroxybutyl)Ethanamide; (R,S)-1-N-Di-(4'-Chlorophenyl)Acetamido-2-Butanol; 1-(N-Di-(4'-Chlorophenyl)Acetamido)-2-Butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 |
| CAS Registry Number | 130203-74-6 |
| SMILES | C1=CC(=CC=C1C(C(=O)NCC(CC)O)C2=CC=C(C=C2)Cl)Cl |
| InChI | 1S/C18H19Cl2NO2/c1-2-16(22)11-21-18(23)17(12-3-7-14(19)8-4-12)13-5-9-15(20)10-6-13/h3-10,16-17,22H,2,11H2,1H3,(H,21,23) |
| InChIKey | QJAXJTDUOBFFJZ-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.408°C at 760 mmHg (Cal.) |
| Flash point | 293.329°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(4-Chlorophenyl)-N-(2-Hydroxybutyl)Acetamide |