|
CAS#: 130746-91-7 Product: 2-Diethylaminoethyl 2-(4-Isothiocyanatophenyl)-2-Phenylpropanoate Oxalate No suppilers available for the product. |
| Name | 2-Diethylaminoethyl 2-(4-Isothiocyanatophenyl)-2-Phenylpropanoate Oxalate |
|---|---|
| Synonyms | 2-Diethylaminoethyl 2-(4-Isothiocyanatophenyl)-2-Phenyl-Propanoate; Oxalate; 2-(4-Isothiocyanatophenyl)-2-Phenylpropanoic Acid 2-Diethylaminoethyl Ester; Oxalate; 2-(4-Isothiocyanatophenyl)-2-Phenyl-Propionic Acid 2-Diethylaminoethyl Ester; Oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.54 |
| CAS Registry Number | 130746-91-7 |
| SMILES | S=C=NC2=CC=C(C(C1=CC=CC=C1)(C(OCCN(CC)CC)=O)C)C=C2.O=C([O-])C([O-])=O |
| InChI | 1S/C22H26N2O2S.C2H2O4/c1-4-24(5-2)15-16-26-21(25)22(3,18-9-7-6-8-10-18)19-11-13-20(14-12-19)23-17-27;3-1(4)2(5)6/h6-14H,4-5,15-16H2,1-3H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | AGMGQDOWYGYXDR-UHFFFAOYSA-L |
| Boiling point | 509.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 262.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Diethylaminoethyl 2-(4-Isothiocyanatophenyl)-2-Phenylpropanoate Oxalate |