|
CAS#: 13180-36-4 Product: Ethyl 4-Hydroxy-2-Phenylquinoline-3-Carboxylate No suppilers available for the product. |
| Name | Ethyl 4-Hydroxy-2-Phenylquinoline-3-Carboxylate |
|---|---|
| Synonyms | 4-Oxo-2-Phenyl-1H-Quinoline-3-Carboxylic Acid Ethyl Ester; 4-Keto-2-Phenyl-1H-Quinoline-3-Carboxylic Acid Ethyl Ester; Nsc152205 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 |
| CAS Registry Number | 13180-36-4 |
| SMILES | C2=C1C(=O)C(=C(NC1=CC=C2)C3=CC=CC=C3)C(OCC)=O |
| InChI | 1S/C18H15NO3/c1-2-22-18(21)15-16(12-8-4-3-5-9-12)19-14-11-7-6-10-13(14)17(15)20/h3-11H,2H2,1H3,(H,19,20) |
| InChIKey | KAXJGTFTNGYKFK-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.059°C at 760 mmHg (Cal.) |
| Flash point | 227.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-Hydroxy-2-Phenylquinoline-3-Carboxylate |